IUPAC Nomenclature of Organic Chemistry Questions and Answers

Get help with your IUPAC nomenclature of organic chemistry homework. Access the answers to hundreds of IUPAC nomenclature of organic chemistry questions that are explained in a way that's easy for you to understand. Can't find the question you're looking for? Go ahead and submit it to our experts to be answered.

Homework Help Tools
30,000+ Video Lessons
2,000,000+ Questions and Answers
65,000+ Quizzes
Copyright

IUPAC Nomenclature of Organic Chemistry Questions and Answers

Test your understanding with practice problems and step-by-step solutions. Browse through all study tools.

What is the IUPAC name of the following compound in Fischer projection?
Provide the IUPAC names for the following organic compounds.
Give an IUPAC name for CH3CH2C(CH3)2CH3.
Use the IUPAC nomenclature system to write the name of the following carboxylic acid.
Provide the IUPAC name of the below-mentioned organic compound.
Write the systematic (IUPAC) name of the following compound.
Write the systematic (IUPAC) name of the below-mentioned compound.
Why is it necessary to have a system for the naming of chemical compounds?
What is the difference between a functional group and a parent chain in chemistry?
Using the IUPAC nomenclature system name the following compound
Using the IUPAC nomenclature system, provide the name of the following compound.
Provide the name of the below-mentioned compound using the IUPAC nomenclature system.
Provide the name of the following compound using the IUPAC nomenclature system.
Using the IUPAC nomenclature system, provide the name of the below-mentioned compound.
Using the IUPAC nomenclature system, name the below-mentioned compound.
What is the IUPAC name of the compound mentioned below?
Give the name of the below-mentioned compound.
What is the IUPAC name of the given organic structure?
What is the IUPAC name of the below-mentioned organic structure?
Give the product for the reaction shown below.
Give the product for the below reaction.
Write the IUPAC name of the given organic compound.
Provide the name of the following organic compound using the IUPAC naming system.
Write the name of the given organic compound.
Name the below-mentioned compound using IUPAC rules.
Name the below-mentioned compound using the IUPAC naming system.
Name the below-mentioned organic compound using IUPAC rules.
Name the following organic compound using the IUPAC naming system.
Provide an IUPAC name for the below-mentioned compound and specify stereochemistry.
Name the following alkene and indicate stereochemistry.
What is the name of the below-mentioned organic structure?
Give the name of the below-mentioned compound using the IUPAC naming system.
Name the shown compound below.
Name the shown compound.
Give the name of the below-mentioned organic compound using the IUPAC naming system.
Provide the name of the below-mentioned compound.
Provide the name of the below-mentioned organic compound using the IUPAC naming system.
Write the name of the below-mentioned organic compound using the IUPAC naming system.
Write the name of the below-mentioned organic compound.
What is the name of the below-mentioned compound?
Write the IUPAC name of the below-mentioned compound.
What is the IUPAC name of the below-mentioned organic compound?
What is the IUPAC name of the below-mentioned compound?
Provide a name for the following alkyne.
Write the systematic (IUPAC, or CA) names for the amines shown below. The names should have the format alkanamine. 1. CH3CH2NH2; 2. CH3CH2CH(CH3)CH2CH(NH2)CH3
Write the IUPAC name for each of these compounds.
What is the name of the polymer given below?
Look at the given molecule and answer the following questions. Is there a functional group that will get an ending? (yes or no?)___ Will the ring be numbered clockwise or counterclockwise?___ Is th...
Give the main/longest chain name, functional group name, and IUPAC name of the following organic compound. CH3CH2CH2CH2CH2OH
Using the IUPAC system, write the name of the alkane given below.
Use the IUPAC system, and write the name of the following alkane.
Use the IUPAC system, and write the name for the following alkane.
Using the IUPAC system, write the name for the following alkane.
What is the IUPAC name for the following compound? a) 4-methyl-1-penten-2-ol b) 2-methyl-4-penten-2-ol c) 4-methyl-1-penten-4-ol d) 4-hydroxy-4-methyl-1-pentene e) 4-penten-2-methyl-2-ol
What is the IUPAC name for the following compounds? a. b. c. d.
What is the IUPAC name for the below compound?
Draw the skeletal structure of 2-methyl benzoic acid.
Name each of the below alcohols, including the stereochemistry if cis-trans isomers are possible.
Name each of the following alcohols.
Name each of the following alkanes.
Consider the following structure: Write the proper IPUAC name
Consider the following structure: Will the chain be numbered left to right or right to left?
Consider the following structure: How many carbons are there in the main chain?
Consider the below structure: Write the proper IPUAC name.
Consider the below structure: Will the chain be numbered left to right or right to left?
Consider the below structure: How many carbons are there in the main chain?
Write the IUPAC name and specify the configuration of the compound mevalonic acid.
Write the IUPAC name and specify the configuration of the compound maleic acid.
Write the IUPAC name and specify the configuration of the compound glyceric acid.
What is the IUPAC name for the aldol condensation product in this reaction?
Name each of the below cyclic alkanes, and indicate the formula of the compound.
Draw the structure for 4-ethyl-2,3-diisopropylpentane. This name is incorrect. Give the correct systematic name.
Name each of the following cyclic alkanes.
What is the IUPAC name of the below structure?
In which of the following pairs is the name incorrect? Give the correct name for the formulas indicated. a. Ag_2O, disilver monoxide b. N_2O, dinitrogen monoxide c. Fe_2O_3, iron(II) oxide d. P...
Write the IUPAC name for each compound. Specify the configuration in c.
Write the IUPAC name of the following compounds.
Draw the structural formula for 1,1-dimethoxycyclohexane.
Draw the structural formula for 2-(1-methylethoxy)propane.
Draw the structural formula for 5-oxohexanal.
Write the name or the formula of the given compound. Identify if binary ionic (BI), polyatomic ionic (PI), binary molecular (BM), or acids (A).
What are iso, neo, and sec in organic chemistry?
Write the IUPAC name of each of the below compounds, showing stereochemistry where relevant.
Name the following substances.
Name the given compounds.
For the IUPAC name, draw the corresponding structural formula and line-angle formula. (a) Cyclohexanol (b) Propanone
Draw the structural formula for 3-chlorobutanal.
For each of the following alcohols, give the systematic name and specify whether the alcohol is primary, secondary, or tertiary. Cyclopentane with a methyl group and alcohol group substituted to tw...
Name the following compound. CH3C(CH2CH3)2CH2CH2CH2CH2CH3
Name the following compound. (CH3)3CCH2C(CH3)3
Name the following compound. CH2(CH3)CH2CH2CH(CH3)CH2CH2CH2(CH3)
Name the following compound. CH3C(CH3)2CH2CH(CH3)CH2CH3
Name the following compound. Cyclohexene with bromine atom and methyl group substituted for two hydrogens.
Name the following compound. Cyclohexane with bromine atom and methyl group substituted for two hydrogens.
Name the following compound. Benzene ring with bromine atom and methyl group substituted for two hydrogens
Name the following compound. CH2FCH2F
Name the following compound. (CH3)2CCl-CH(Cl)CH(CH3)(CH2CH3)
Name the following compound. CH3CH2CH2CCl3
Name the following compound. ClCH2CH2CH(Cl)CH3
Name the following compound. (CH3)(CH3CH2)C=C(CH2CH3)(CH2CH2CH3)
Name the following compound. CH3HC=CHBr
Draw the structural formula for ethyl methanoate.
Draw the structural formula for 3-methylpentanoic acid.
Draw the structure of trans-2-butene.
Name the following alkene CH2=C(CH3)CH(CH2CH3)CH3.
Write the IUPAC name of the below alkene.
Draw the structure of the compound 2,4-heptadiene.
Write the IUPAC and, where possible, a common name for the below compounds.
Write the IUPAC name for each compound by combining the proper prefix, infix, and suffix.
Write the IUPAC names of the following molecules on the lines provided. Include R or S and E or Z designation where appropriate.
Write IUPAC names for the below alkanes.
The circuit shows is powered by a battery with 10 V. R1 = 42 ohms, R2 = 16 ohms, and R3 = 33 ohms. Find the change in potential across R1.
Write the IUPAC name for the compound described as a three-carbon cyclic molecule with a hydroxyl functional group.
Write the IUPAC name for the compound described as a six-carbon cyclic molecule with a ketone functional group.
Write the IUPAC name for the compound CH3C(OH)HCH3.
Write the IUPAC name for the compound CH3CH2CH2CH2CH2COOH.
Write the IUPAC name for the compound CH3CH2COH.
Write the IUPAC name for the compound CH3CH2COCH3.
Name the following alkane. CH3C(Br)2CH(CH3)CH2CH3
Write the structural formula for Triphenylamine.
Name the following alkyne. HCCC(CH3)HC(CH2CH3)(CH2CH2CH2CH3)H
Name the following alkyne. CH3C(CH3)(CH2CH2Cl)CCC(CH3)2H
Name the following alkene. CH3CH2C(CH2CH3)HCHCHCH2C(CH3)2H
Determine what is wrong with the compound name 2-bromo-3-butanol. Give the correct name for the compound.
Determine what is wrong with the compound name cis-4-methyl-3-pentene. Give the correct name for the compound.
Determine what is wrong with the compound name 2-ethylpropane. Give the correct name for the compound.
Draw the incorrectly named compound 2-ethyl-3-butyne and name it correctly.
Draw the incorrectly named compound 3-methyl-4-isopropylpentane and name it correctly.
Draw the incorrectly named compound 2-ethyl-4-tert-butylpentane and name it correctly.
Draw the incorrectly named compound 2-ethyl-3-methyl-5-isopropylhexane and name it correctly.
Write the name of the organic compound CH3CH2COCH2CH2CH3.
Explain why 2,2-diethylheptane is an incorrect IUPAC name and write the correct IUPAC name for the intended compound.
Explain why 2-propylpentane is an incorrect IUPAC name and write the correct IUPAC name for the intended compound.
Explain why 2-ethyl-3-methylpentane is an incorrect IUPAC name and write the correct IUPAC name for the intended compound.
Explain why 2,2-diethylbutane is an incorrect IUPAC name and write the correct IUPAC name for the intended compound.
Explain why 4-methylpentane is an incorrect IUPAC name and write the correct IUPAC name for the intended compound.
Explain why 1,3-dimethylbutane is an incorrect IUPAC name and write the correct IUPAC name for the intended compound.
Provide the function class of the given structure.
Provide the IUPAC name of the given molecule.
What is the parent chain of the given compound?
Give the IUPAC name for the given molecule.
Name the alkene below.
What is the systematic name of the given compound?
What is the systematic name for the given compound?
What is the systematic name for the compound shown below?
Predict the IUPAC name of the given compound.
Write the IUPAC name of the compound shown below.
Write the IUPAC name of the compound below.
Find the IUPAC name of the compound below.
Name the given compound by IUPAC.
Name the given monosubstituted benzene.
Identify the IUPAC name of the compound.
Identify the IUPAC name for the compound shown below.
The stench of decaying proteins is due in part to two compounds whose structures and common names are H2NCH2CH2CH2CH2NH2 , putrescine H2NCH2CH2CH2CH2CH2NH2 , cadaverine Name these compounds as a...
Determine the IUPAC name for the depicted compound.
Provide the IUPAC name for the depicted compound.
Identify the IUPAC name for the compound below.
What is the IUPAC name of the given molecule?
Name the IUPAC of the given molecule.
Classify the amine below, as either primary (or 1st) amine, secondary (or 2nd) amine, or tertiary (3rd) amine.
Classify the amine below by writing under the structure either primary (or 1st) amine, or secondary (or 2nd) amine, or tertiary (3rd) amine.
Give the IUPAC name and write the structural formula of the compound below.
Provide the IUPAC name and write the structural formula of the given compound.
Write the structural formula and provide the IUPAC name of the depicted compound.
For the given compound, write the structural formula and give the IUPAC name.
Write the structural formula and give the IUPAC name of the depicted compound.
Write the structural formula and identify the IUPAC name of the given compound.
Write the structural formula and give the IUPAC name of the given compound.
Name the given compound. (red = O, blue = N)
Determine the IUPAC name of the depicted compound.
Determine the IUPAC name of the compound below.
Identify the IUPAC name of the compound below.
Provide the IUPAC name of the compound shown below.
Give the IUPAC name of the compound shown below.
Provide the name of the compound below.
Provide the name of the given compound.
What is the IUPAC name for the molecule shown below? A) 2-methyl-5-propyl-3-heptyne B) 5-ethyl-2-methyl-3-octyne C) 1-isopropyl-3-ethyl-1-hexyne D) 6-methyl-3-propyl-4-heptyne E) 4-ethyl-7-meth...
Give IUPAC name for the compound below.
How many \sigma and \pi bonds are there in the given molecule? 1-butyne
Give the IUPAC name of the given alkene.
Give IUPAC name for the depicted substance (red=O, blue=N).
Give IUPAC name for the given substance (red=O).
Name the given amine and identify it as primary, secondary, or tertiary.
Provide the IUPAC name for the given compound (red=O).
Write the structural formula of m-nitrophenol.
Give IUPAC name for the given compounds (red=O, blue=N):
The mentioned name is incorrect. Draw the stated molecule, and write the correct name. 2-Ethyl-3-methylcyclohexene
The depicted name is incorrect. Draw the given molecule, and write the correct name. 6-Ethylcycloheptene
The mentioned name is incorrect. Draw the given molecule, and give its correct name. 1-Methylcyclopent-2-ene
Draw the structure corresponding to the specified IUPAC name. (E)-3-Methylhept-3-ene
Draw the structure corresponding to the depicted IUPAC name. Octa-1,5-diene
Draw the structure corresponding to the mentioned IUPAC name. 2,4-Dimethylhex-2-ene
Draw the structure corresponding to the given IUPAC name. 3-Propylhept-2-ene
Draw the structure corresponding to the given IUPAC name: 2,3-Dichloro-4-methylhexane
Give the IUPAC name for the depicted substance, and convert the drawing into a skeletal structure.
Give the IUPAC name for the mentioned substance, and convert the drawing into a skeletal structure.
Write out the name of the given cycloalkene.
Devise the IUPAC name of the quoted compound.
Devise the IUPAC name of the depicted compound.
Give the IUPAC name for the quoted compound.
Elucidate the IUPAC name for the mentioned compound.
Write out the IUPAC name of the indicated alkene.
Write out the IUPAC name of the stated alkene.
Name the specified cycloalkene using IUPAC rules.
Name the indicated cycloalkene by using IUPAC rules.
Name the given cycloalkene using IUPAC rules.
Give the IUPAC name for the stated alkene.
Give IUPAC name for the mentioned alkene.
Name the depicted alkene.
A compound is given. Name the compound.
Devise the IUPAC name for the indicated compound.
Name the depicted thiol using IUPAC rules.
Name the given thiol by using IUPAC rules.
Draw a chiral molecule that meets the given description. An alcohol, C6H14O
Name the stated ether using IUPAC rules. (CH3)2CHCH2OCH2CH3
Propose a structure for the compound that meets the given description. A chiral carboxylic acid
Name the depicted ether using IUPAC rules.
Name the mentioned ether by IUPAC rules.
Name the given ether by IUPAC rules.
Name the quoted compound according to IUPAC rules. NH2CH2CH2CH2CN
Check out the name of the given compound according to IUPAC rules.
Name the specified compound according to IUPAC rules.
Name the stated compound according to IUPAC rules.
Elucidate the name of the compound using IUPAC rules.
Devise the name of the given compound according to IUPAC rules.
Give the IUPAC name for the specified alkane.
Give the IUPAC name for the mentioned alkane.
Draw the structure corresponding to the depicted IUPAC name. 1-Ethyl-4-isopropylcyclohexane
Draw the structure corresponding to the given IUPAC name. 1-teri-Butyl-2-methylcyclopentane
Draw the structure corresponding to the following name. 4-methylpentanoic acid.
Draw structures corresponding to the following IUPAC names: (a) N,N-Dimethylaniline (b) N-Methylcyclohexylamine (c) (Cyclohexylmethyl)amine (d) (2-Methylcyclohexyl)amine (e) 3-(N,N-Dimethylamino)pr...
Draw structural formula for 4-ethyl-3,4-dimethyloctane.
Draw structural formula for 4-ethyl-2-methylhexane.
Draw the structure for the stated amine. 3-Methylindole
Draw the structure corresponding to the indicated IUPAC name. Cyclohexane-1,3-dione
Draw the structure corresponding to the stated IUPAC name. 2,2-Dimethylcyclohexanecarbaldehyde
Draw the structure corresponding to the mentioned IUPAC name. 4-Chloropentan-2-one
Draw the structure corresponding to the given IUPAC name. 3-Methylbut-3-enal
Write out the name the depicted ketone.
An aldehyde is given. Name the aldeyhde. OHCCH2CHCH2CHO
What can be said about the name of the given aldehyde?
Name the given aldehyde.
Name the given ketone.
Name the depicted compound using IUPAC rules.
Devise the name of the compound using IUPAC rules.
Name the indicated compound according to IUPAC rules.
Name the depicted compound according to IUPAC rules.
Name the mentioned compound according to IUPAC rules.
Name the given compound according to IUPAC rules.
Name the specified compound by IUPAC rules.
Name the indicated compound using IUPAC rules.
Name the stated compound using IUPAC rules.
Name the mentioned compound using IUPAC rules.
Name the given compound using IUPAC rules. CH3NHCH2CH3
Draw structures corresponding to the following IUPAC names: (a) 4,5-Dimethylheptanoic acid (b) cis-Cyclohexane-1,2-dicarboxylic acid (c) Heptanedioic acid (d) Triphenylacetic acid (e) 2,2-Dimethylh...
alpha-Farnesene is a constituent of the natural waxy coating found on apples. What is its IUPAC name?
Draw structures corresponding to the following names: (a) m-Bromophenol (b) 1,3,5-Benzenetriol (c) p-Iodonitrobenzene (d) 2,4,6-Trinitrotoluene (TNT) (e) o-Aminobenzoic acid (f) 3-Methyl-2-ph...
In the given set, which structure represents the same compound and which represents a different compound?
Name the indicated alkyl halide according to the IUPAC rules.
Name the given alkyl halide according to IUPAC rules.
Give the IUPAC name of the specified alkyl halide.
Give the IUPAC name of the depicted alkyl halide.
Give the IUPAC name of the mentioned alkyl halide.
Draw the structure corresponding to the depicted IUPAC name. p-Bromoaniline
Give the IUPAC name for the designated carboxylic acid derivative.
Give the IUPAC name for the cited carboxylic acid derivative.
Give the IUPAC name for the indicated carboxylic acid derivative. CH3CH(Br)CH2CONHCH3
Give the IUPAC name for the specified carboxylic acid derivative.
Give the IUPAC name for the depicted carboxylic acid derivative. (CH3CH2)2CHCH=CHCN
Give the IUPAC name for the mentioned carboxylic acid derivative.
Write the name and the formula of the compound or ion represented by the given model. Black=C and White=H.
Give the IUPAC name for the referred carboxylic acid.
Give the IUPAC name for the given carboxylic acid.
Mescaline, a powerful hallucinogen derived from the peyote cactus, has the systematic name 2-(3,4,5-trimethoxyphenyl)ethylamine. Draw its structure.
Draw structures corresponding to the following IUPAC names: (a) 2-Methylhexan-2-ol (b) Hexane-1,5-diol (c) 2-Ethylbut-2-en-1-ol (d) Cyclohex-3-en-1-ol (e) o-Bromophenol (f) 2,4,6-Trinitrophenol
Identify the IUPAC name of the depicted compound.
Identify the IUPAC name for the depicted compound.
Give the IUPAC name of the compound below.
What is the IUPAC name of the given compound?
Identify the IUPAC name of the given compound.
Identify the IUPAC name for the given compound.
Check out the IUPAC name of the given compound.
Write out the IUPAC name for the mentioned compound.
Elucidate the IUPAC name for the given compound.
Give the IUPAC name for the concerned compound.
Give the IUPAC name for the concerned structure.
A compound is given. Write the IUPAC name of the compound.
Give the IUPAC name for the referred structure.
Give the IUPAC name for the quoted structure.
Give the IUPAC name for the indicated structure.
What can be said about the IUPAC name of the mentioned structure?
Give the IUPAC name for the indicated cycloalkane.
Give the IUPAC name for the mentioned cycloalkane.
Draw the structure corresponding to the mentioned name. 3,5-Dinitrobenzaldehyde
Provide the IUPAC name of the depicted compound.
Provide the IUPAC name of the compound below.
Write the IUPAC name of the depicted compound.
Write the IUPAC name for the depicted compound.
Give the IUPAC name for the indicated compound.
Give the IUPAC name for the stated compound.
Name the depicted amine.
Name the amine below.
Name the amine shown below.
Name the given amine.
(a) Describe the reaction of ethane with chlorine in ultraviolet light. (b) Write equations that show structural formulas for all compounds that can be formed by reaction (a). (c) Give the IUPAC...
Write the structural formula for o-chlorophenol.
Write the structural formula for 2-methoxy-3-methylbutane.
(a) Define esters. (b) Write structural formulas for four esters, and give their IUPAC names.
Is (CH_3)_2CHNH_2 a secondary amine? Give a reason for your answer.
Cite three examples (each) of aliphatic and aromatic aldehydes and ketones by drawing structural formulas, and give the IUPAC names of the compounds.
Name the following compound by the IUPAC system. CH_3CH(CH_3)CH_2CH_2CH_3 Draw a different constitutional isomer of this compound and give its correct IUPAC name.
Draw the structure corresponding to the mentioned IUPAC name. 3,3-Dimethyloct-4-yne
Draw the structure corresponding to the prescribed IUPAC name. Hept-3-yne
Draw the structure corresponding to the designated IUPAC name. 1-Methylcyclopenta-1,3-diene
Draw the structure corresponding to the stated IUPAC name. Hepta-1,5-diyne
Draw the structure corresponding to the given IUPAC name. 3-Ethylhept-1-yne
Draw the structure corresponding to the cited name. p-Bromobenzonitrile
Draw the structure corresponding to the prescribed name. cis-3-Methylcyclohexanecarbonyl bromide
Draw the structure corresponding to the specified name. Tert-Butyl butanoate
Draw the structure corresponding to the given name. 2,2-Dimethylpropanoyl chloride
Devise the IUPAC name for the given structure.
Give the IUPAC name for the designated structure.
Give the IUPAC name for the specified structure.
Give the IUPAC name for the depicted structure.
Give the IUPAC name for the mentioned structure.
Give the IUPAC name for the quoted carboxylic acid.
Give the IUPAC name for the specified carboxylic acid.
Give the IUPAC name for the depicted carboxylic acid.
Give the IUPAC name for the mentioned carboxylic acid.
Devise an IUPAC name for the mentioned compound. CH3CH=CHCH2C = CCH3
Give the IUPAC name for the specified compound.
Give the IUPAC name for the depicted compound.
Using IUPAC rules, name the depicted compound.
Devise the IUPAC name of the specified compound.
Draw the structure of the given cycloalkene. cis-4,5-Dimethylcyclohexene
Propose the structure and give the correct IUPAC name for the given species. A dimethyl octane
Draw the structure of cis-1-chloro-3-methyl cyclopentane.
Give a systematic name for the depicted compound. (Pt(NH3)4Cl2)
Give the name of the following structure.
Identify and name the functional group(s) in the given compound.
Work out the name of the given compound.
A compound is given. What is the name of the compound?
Interpret the name of the given compound.
Deduce the name of the depicted compound.
A compound is depicted. Write the name of the compound.
Name the given compound. CH3CH(CH3)CH2CH2OH
Classify the class of organic compounds (ester, ether, ketone, etc.) to which the depicted compound belongs.
Use IUPAC rules and name the compound.
Formulate using the IUPAC rules, the name of the compound.
Provide the IUPAC name using the rules.
Apply IUPAC rules and name the given compound. CH3CH2CH2CH2NH2
Write out the IUPAC name of the compound.
Deduce if the given compound is a phenol. Write the IUPAC name of the compound.
Tell whether the given compound is a phenol. Name the compound.
Deduce the name of the given ester.
Name the given ester.
Compose the IUPAC name of the given compound.
Depict the name of the given ester.
Elucidate the IUPAC name of the given halide. CH2ClCH2Cl
Write the IUPAC name for the depicted halide.
Devise the name using IUPAC rules.
Taking help of IUPAC rules, name the compound.
Elucidate the IUPAC name of the compound using the nomenclature rules.
Formulate the IUPAC name using the nomenclature rules.
Compose the IUPAC name for the given compound.
Give the IUPAC name for the mentioned compound.
Mention the IUPAC name for the given compound.
Account for the IUPAC name of the depicted compound. CH3CH(CH3)CH(CH3)CH2CH3
Formulate the IUPAC name of the given compound. CH3CH2CH2CH(CH3)2
Deduce the IUPAC name of the mentioned compound. CH3CH(CH2CH2CH3)CH2CH3
Write out the IUPAC name of the given compound. CH3CH2CH(CH2CH3)CH2CH3
Elucidate the IUPAC name of the mentioned compound.
Check out the name of the given compound.
Give IUPAC name of the given compound:
Compose the structure of the mentioned compound. 3-ethylheptane
Draw the structure of the given compound. 2,3-dimethylhexane
What can be said about the IUPAC name of the given compound?
Deduce the IUPAC name for the given compound.
The given name is incorrect. Give the proper IUPAC name. 3-Ethyl-4,4-dimethylhexane
The given name is incorrect. Give the proper IUPAC name. 4-Ethyl-5,5-dimethylpentane
The given name is incorrect. Give the proper IUPAC name. 2,2-Dimethyl-6-ethylheptane
Give IUPAC name for the given compound: H2C=CHCH2CH2CH=CHCH3
Give IUPAC name for the given compound: CH3CH2CH=CHCH2CH2CH3
Name the given binary molecular compound. AF3
Write the name of the given compound.
Write the name of the following compound.
Name the mentioned common anion using the IUPAC system of nomenclature. ClO3-
Account for the name of the given pure compound. MgH2
Describe the bonding at each carbon atom in: (a) ethene (b) methylpropene (c) 2-butene (d) 3-methyl-1-butene.
Account for the name of the given compound. CH3OH
Provide a systematic name for the following compound.
What is the IUPAC name of the shown compound?
Write the I.U.P.A.C name of the given compound. CH3CH2CHCH2CH3.
What is the I.U.P.A.C name of the compound CH2CH2CH2CH3?
Name the given organic compound.
What can be said about the name of the given compound?
Using the IUPAC rules, name the given compound.
Name the organic compound shown below.
Account for the name of the given compound.
Write out the name of the given compound.
Create an account to browse all assets today
Support