Write a balanced equation for the reaction between solid aluminum oxide and solid carbon to...
Question:
Write a balanced equation for the reaction between solid aluminum oxide and solid carbon to produce solid aluminum and carbon dioxide gas. Express the answer as a chemical equation. Identify all of the phases in the answeres
Balanced chemical equation
A balanced chemical equation is defined as the chemical equation which has an equal number of participating atoms on both sides. A balanced chemical equation is based on the law of conservation of mass.
Answer and Explanation:
Become a Study.com member to unlock this answer! Create your account
View this answerSee full answer below.
Ask a question
Our experts can answer your tough homework and study questions.
Ask a question Ask a questionSearch Answers
Learn more about this topic:
Get access to this video and our entire Q&A library
Balanced Chemical Equation: Definition & Examples
from
Chapter 10 / Lesson 18
966K
Learn about the steps to balancing chemical equations. Understand how to balance chemical equations, practice balancing chemical equations, and see examples.
Related to this Question
- Write a balanced equation for the following reaction: Solid aluminum carbonate decomposes to form solid aluminum oxide and carbon dioxide gas.
- Write a balanced chemical equation to represent solid aluminum metal reacting with oxygen gas to form solid aluminum oxide.
- Write the balanced chemical equation for solid aluminum reacting with oxygen to produce aluminum oxide.
- Solid aluminum carbonate decomposes to form solid aluminum oxide and carbon dioxide gas. Write the balanced equation.
- Set up a balanced chemical equation for the following reaction: Aluminum carbonate \to Aluminum oxide + Carbon dioxide.
- You can produce your own aluminum oxide by reacting oxygen gas with aluminum metal. Write out a balance equation for this reaction.
- Write a balanced chemical equation to represent the following chemical reaction. aluminum + oxygen arrow aluminum oxide
- Write the chemical equation for the following reaction. Solid copper (II) oxide and solid aluminum metal react to form copper metal and solid aluminum oxide.
- Write a balanced chemical equation for the following reaction. Manganese(IV) oxide reacts with aluminum to form elemental manganese and aluminium oxide.
- Write a balanced chemical equation for the reaction that occurs when aluminum metal undergoes a synthesis reaction with Br2 (l).
- 5. Write a balanced chemical equation for each of the following reactions. No need to give physical states. a). Combustion of propanol (C_3H_8O) b). Manganese(III) oxide reacts with aluminum metal t
- Write and balance equations for the following reactions. A) Iron metal and chlorine gas react to form solid iron(III) chloride. B) Solid aluminum carbonate decomposes to form solid aluminum oxide and
- Write a balanced equation for the reaction between solid iron(III) oxide and carbon monoxide gas that produces solid iron and carbon dioxide gas.
- Write a balanced equation for the thermal decomposition of aluminum nitrate to form aluminum oxide, nitrogen dioxide, and oxygen. Include all state symbols.
- Write a balanced equation of the decomposition of aluminum carbonate.
- Write the balanced equations for the oxidation of aluminum metal by atmospheric oxygen to form aluminum (III) oxide.
- Write the balanced half ionic equation when aluminum oxide is decomposed to aluminum and oxygen.
- Solid cobalt(III) oxide reacts with solid carbon to form solid cobalt and carbon dioxide gas. Write the balanced equation for this reaction.
- Write a balanced equation for the reaction that occurs when carbon monoxide gas and oxygen gas combine to form carbon dioxide gas. Indicate the type of reaction.
- Write the balanced chemical equation for the given combination reaction as described by words, and assign oxidation states to elements other than H and O. Sulfur trioxide reacts with aluminum oxide to form aluminum sulfate.
- Write a balanced equation for the reaction between solid chromium (III) oxide and solid carbon to produce solid chromium and carbon dioxide gas.
- Write a balanced chemical equation and classify the reaction that occurs when copper metal is heated with oxygen to give solid coper (II) oxide.
- Write a balanced chemical equation for the following reaction: Manganese (IV) oxide reacts with aluminum to form manganese and aluminum oxide.
- Write a balanced chemical equation: aqueous solutions of aluminium chloride and sodium carbonate are combined, producing aluminium carbonate.
- Write a balanced chemical equation for each of the following. Express the answer as chemical equation and identify the phases in the answers. 4. Gaseous carbon monoxide reacts with oxygen gas to form carbon dioxide gas.
- Write the balanced chemical equation for the reaction that occurs when aluminum metal and sulfuric acid are combined to produce aqueous aluminum sulfate and hydrogen gas.
- Write a balanced chemical equation and classify the reaction below. Aluminum metal and sulfuric acid yield aqueous aluminum sulfate and hydrogen gas.
- Write the coefficients to balance the chemical equation for the following reaction: Tin (IV) oxide reacts with carbon to form tin and carbon monoxide. (blank) SnO2 + (blank) C arrow (blank) Sn + (blank) CO.
- Write the chemical formula, balanced equation, and state the type of reaction for aluminum iodide reacting with oxygen to form aluminum oxide and iodine.
- Aluminum metal reacts with iron (III) oxide to produce aluminum oxide and iron metal. Answers the following two questions. Note: you will need to write a balanced equation to answer them. Al: 26.9
- Write a balanced chemical equation for the following reaction. Copper(II) oxide reacts with elemental C to form elemental copper and carbon dioxide.
- Write a balanced chemical equation for the following reaction, identifying the phase of each substance. Gaseous carbon monoxide reacts with oxygen gas to form carbon dioxide gas.
- Aluminum hydroxide reacts with carbonic acid to produce aluminum carbonate and water. Write the balanced chemical equation for this reaction and classify it as a double/single replacement, combustion, synthesis, or decomposition reaction.
- A. Write the balanced equation for reaction of aluminum with oxygen. B. Show the electron configuration and changes for each atom in this reaction. C. Show the Lewis structures for the reactants and the products.
- Write a balanced chemical equation for each of the following. Part A Solid copper reacts with solid sulfur to form solid copper(l) sulfide. Part B Liquid octane reacts with oxygen gas to form carbon
- Write a balanced chemical equation for each of the following reaction a). combustion of propanol (C_3H_8O) b). manganese(III) oxide reacts with aluminum metal to form manganese metal and aluminum ox
- Give the balanced equation for the reaction of aluminum with oxygen.
- Aluminum reacts with HBr to form aluminum bromide and hydrogen gas. \\ Write a balanced chemical equation for this reaction.
- Write the balanced equation for the reaction that occurs between aqueous solutions of aluminum nitrate and potassium carbonate.
- Write a balanced equation for the reaction between solid silver monoxide and solid carbon to produce solid silver and carbon dioxide gas.
- Write a balanced equation for the reaction of solid calcium carbonate decomposing to produce solid calcium oxide and carbon dioxide gas.
- Write the balanced chemical equation for the reaction of aluminum with hydrochloric acid.
- Write a balanced chemical equation for each of the following: Solid copper reacts with solid sulfur to form solid copper(I) sulfide Liquid octane reacts with oxygen gas to form carbon dioxide gas an
- Write a balanced equation for aluminum and sulfur reacting to produce aluminum sulfide.
- Write a balanced equation for the reaction that occurs when aluminum is combined with hydrochloric acid.
- Write a balanced chemical equation for gaseous carbon monoxide reacting with oxygen gas to form carbon dioxide gas.
- Write a balanced equation (including physical states) for the following reaction: \\ Sodium carbonate, upon heating, produces sodium oxide and carbon dioxide.
- Write the balanced chemical equation for the reaction of aluminum and copper chloride to form aluminum chloride and copper.
- Write a balanced chemical equation to represent the reaction of solid magnesium and gaseous oxygen to form solid magnesium oxide.
- Write a balanced equation and indicate the type of reaction for iron(iii) oxide and carbon monoxide into iron and carbon dioxide.
- Write a balanced equation using the correct formula and include conditions (s, l, g or aq) for the following reaction: Liquid hexene (C6H12) burns in oxygen gas to form carbon dioxide gas and water va
- Write a balanced chemical equation for the following: Gold(III) oxide is heated producing gold metal and oxygen gas.
- Write a balanced chemical equation to represent the following chemical reaction. aluminum + sulfuric acid arrow aluminum sulfate + hydrogen
- Write a balanced chemical equation for the following reaction, identifying the phase of each substance. Gaseous acetylene ( C 2 H 2 ) reacts with oxygen gas to form gaseous carbon dioxide and gaseous water.
- Write a balanced chemical equation for the reaction between silver nitrate and aluminum. What type of reaction is this?
- Write a balanced equation for the following reaction. Write the correct formulas of the reactants and products and the states of each. Liquid pentane (C5H12) and oxygen (O2) gas react to form carbon dioxide and water.
- Write the balanced molecular equation and net ionic equation for the reaction that occurs when solid aluminum oxide reacts with a solution of hydrochloric acid.
- Write the balanced chemical equation for the decomposition of potassium carbonate to form potassium oxide and carbon dioxide.
- Write the balanced chemical equation to represent the following reaction. aluminum sulfate + sodium hydroxide arrow aluminum hydroxide + sodium sulfate
- Write a balanced chemical equation for the following: Aluminum metal is dissolved in sulfuric acid to form aluminum sulfate and hydrogen gas.
- Write balanced formula unit equation for the reaction described by words below. Carbon reacts with hot concentrated nitric acid to form carbon dioxide, nitrogen dioxide, and water.
- Write a balanced equation for the following reaction. Write the correct formulas of the reactants and products and the states of each. Iron and oxygen (O2) gas react to form iron(III) oxide
- Write a balanced equation describing each of the following chemical reactions. (a) Solid potassium chlorate, KClO3, decomposes to form solid potassium chloride and diatomic oxygen gas. (b) Solid aluminum metal reacts with solid diatomic iodine to form s
- Write a balanced equation for the reaction of aluminum metal with copper (II) sulfate.
- Write a balanced equation for the reaction: Solid sodium bicarbonate is heated and forms solid sodium carbonate, gaseous carbon dioxide, and water. (Express your answer as a chemical equation. Identify all of the phases in your answer.)
- Write the balanced equation for the reaction first. Aluminum combines with excess copper (II) sulphate in a single replacement reaction.
- Write a balanced equation and indicate the states for the reaction: Aluminum (s) and sulfuric acid.
- Write a balanced chemical equation for the reaction of carbon described below. Iron(II) oxide reacts with carbon above temperatures of about 700 degrees Celsius to produce carbon monoxide gas and molten elemental iron.
- Balancing Equations Sucrose(C12H22O11) and oxygen produce a solid carbon, water and 3 units of carbon dioxide. Write a balanced equation for this reaction.
- Write the chemical formula, balanced equation, and state the type of reaction for octane ( C 8 H 18 ) combining with oxygen when a spark is provided to form carbon dioxide and water.
- Write a balanced equation for the reaction of nitrogen oxide gas reacting with carbon monoxide gas to produce nitrogen gas and carbon dioxide gas.
- Write a balanced chemical reaction for the complete combustion of tridecane, (C13H28) in oxygen. Express your answer as a chemical equation.
- Write a balanced chemical equation for the following word equation. Aluminum acetate reacts with potassium hydroxide to form aluminum hydroxide and potassium acetate.
- Write balanced chemical equations for the following: Aluminum metal is dissolved in sulfuric acid to form aluminum sulfate and hydrogen gas
- Most metals will react with O2 from the air to form a thin layer of metal oxide on their surface. Aluminum will oxidize into Al2O3. Al2O3 will react with HCl. a. Write the complete and balanced molecular equation for Al2O3 + HCl. b. Write the total ionic
- Write a balanced chemical equation, including physical state symbols, for the combustion of liquid dodecane into gaseous carbon dioxide and gaseous water.
- Write a balanced equation for the reaction. Write the correct formula of the reaction and the products and state. Iron and oxygen (O_2) gas react to form iron(III) oxide.
- Write a balanced equation for the reaction. Write the correct formula of the reaction and the products and state. Liquid pentane (C_5H_{12}) and oxygen (O_2) gas react to form carbon dioxide and water.
- Write a balanced chemical equation to represent the following chemical reaction. iron(III) oxide + carbon arrow iron + carbon monoxide
- write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-C C-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxi
- Write balanced equations for the following reactions and name the products. (a) magnesium oxide, MgO, with sulfur dioxide, SO_2 (b) calcium oxide, CaO, with carbon dioxide, CO_2
- Write the balanced equation for aluminum reacting with gaseous chlorine to give aluminum chloride.
- Write a balanced chemical equation for the reaction that occurs when barium carbonate decomposes into barium oxide and carbon dioxide gas when heated. Express your answer as a balanced chemical equati
- Write a balanced equation for the reaction between copper (I) sulfide with oxygen gas to produce copper metal and sulfur dioxide.
- Write a balanced chemical equation for the reaction that occurs when barium carbonate decomposes into barium oxide and carbon dioxide gas when heated.
- Balance the following equation and identify what type of reaction it is. Al(OH)3 arrow Al2O3 + H2O
- Write a balanced chemical equation that shows the formation of pentanoic acid from the elements carbon (C), hydrogen (H2), and oxygen (O2).
- Write balanced molecular equations in standard form, include all phases for all equations: 1) Solid iron (III) oxide and aluminum metal react to form iron metal and solid aluminum oxide. 2) Solid calcium fluoride reacts with liquid sulfuric acid to form s
- Write the balanced chemical equation for the reaction of aluminum with KOH.
- Aqueous aluminum hydroxide yields solid aluminum oxide and water a. Give the chemical equation for this reaction. b. Balance the equation. c. Identify the type of reaction.
- Write the balanced combustion equation for solid carbon. Remember that combustion is a type of synthesis reaction. a. C + O ---> CO b. 2C + O_2 ---> 2CO c. C_2 + O_2 ---> 2CO d. C + O_2 ---> CO_2 + H_2O
- Write a balanced chemical equation, including physical state symbols, for the combustion of gaseous methane into gaseous carbon dioxide and gaseous water. CH_4 (g) + 2O_2 (g) to CO_2 (g) + 2H_2O(g)
- Write balanced chemical equations for each of the following reactions and show the states (gas, solid, liquid, aqueous, etc.). a) Sodium metal with water b) Rubidium metal with dioxygen c) Solid potassium hydroxide with carbon dioxide d) Heating solid
- Write the balanced equation for the reaction of nitric acid with aluminum hydroxide to form water and aluminum nitrate.
- Write a balanced chemical equation for the following reaction. calcium carbonate (s) to{Delta} calcium oxide (s) + carbon dioxide (g)
- Write the balanced chemical equation for the dissolution of aluminum nitrate in water. The chemical symbol for aluminum is Al.
- Write a balanced equation for the reaction of copper sulfate with aluminum. Include state symbols. What type of reaction is this?
- Write a balanced chemical equation for each of the following. Express the answer as chemical equation and identify the phases in the answers. 1. Gaseous acetylene (C_{2}H_{2}) reacts with oxygen gas to form gaseous carbon dioxide and gaseous water.
- Write the balanced equation for the reaction of aluminum with copper(II) sulfate solution.
- Solid aluminum metal reacts with solid diatomic iodine to form solid Al2I6. Write a balanced equation describing the chemical reaction.
Explore our homework questions and answers library
Browse
by subject