What is the IUPAC name for the following ?

Question:

Amines:

Organic compounds with the general formula {eq}R-NH_2 {/eq} are known as amines. When naming amines, identify the longest continuous carbon chain containing the {eq}-NH_2 {/eq} group. Name the parent chain and specify the position of the {eq}-NH_2 {/eq} group.

Answer and Explanation:

Become a Study.com member to unlock this answer! Create your account

View this answer

See full answer below.

Learn more about this topic:

Naming Amines Using IUPAC Nomenclature

from

Chapter 4 / Lesson 4

33K

Amines are organic molecules containing at least one nitrogen atom. Explore the naming conventions for amines using the IUPAC nomenclature system, including references to the carbon group attached to the nitrogen atoms.

Related to this Question

What is the IUPAC name of the following?
What is the IUPAC name for the below compound?
Give the IUPAC name for the following:
What is the IUPAC name of the below structure?
What is the IUPAC name for the below molecule?
Give the IUPAC name for the below compound.
Write the IUPAC name for the following: (a) N_2O (b) CuO (c) NaHCO_3
Write the IUPAC name for the following.
What is the IUPAC name of these? 1) ch3ch2c(ch3)2ch2ch2ch3 2) CH3CH(CH3)CH(CH3)CH2CH2CH3
what is the IUPAC name of (CH3)2CH-O-C3H5
What is the IUPAC name for
What is the IUPAC name?
What is the IUPAC name for CH3-O-CH2-CH3?
What is the IUPAC name? CH3 CH3CH-O-C3H5
What is the IUPAC name for: CH3-CH2-CH2-CH2-CH2-CH3?
What is the IUPAC name for the given compound?
What is the IUPAC name for the given compound below?
What is the IUPAC name of the given compound?
What is this compound? Give the IUPAC name.
What is the IUPAC name for the following alkane?
What is the correct IUPAC name?
What is the IUPAC name of the shown compound?
What is the IUPAC name for the compound shown?
What is the IUPAC name for the compound shown below? HO
What is the IUPAC name of the following compound shown below?
What is the IUPAC name for the following compound as shown below ?
What is the IUPAC name of the compound shown?
What is the IUPAC name for the compound shown below?
What is the IUPAC name for the following compound shown below?
What is the IUPAC name for the compound shown below? H2N
What is the IUPAC name for the compound shown below? H3C CH3 CH3 CH2
What is the IUPAC name for the compound?
What is the IUPAC name of following compound?
What is the IUPAC name of the following compound? CH3-C(CH3)2-CH2-CH2-OH
What is the IUPAC name of the compound?
What is the IUPAC name for the compound below?
What is the IUPAC name for the compound as seen below?
What is the IUPAC name for this compound?
What is the IUPAC name for the following compound? CH3 CH2 CH2 CH2 CH3
What is the IUPAC name for the following compound?
What is the IUPAC name for the following compound seen below?
What is the IUPAC name of the compound below?
What is the IUPAC name of the following compound?
What is the IUPAC name of the compound (1R, 2S, 3S)-2-Bromo-3, 3-difluoro-1-iodobutane.
What is the IUPAC name for the compound seen below?
What is the IUPAC name for the following compound? CH3-CH2-CH2-CH2-CH2-CH2-CH2-CH2-CH3
What is the IUPAC name for the following compound? (A) (25)-fluorobutanenitrile (B) (2R)-fluoropentanenitrile (C) (3R)-fluoropentanenitrile (D) (35)-fluoropentanenitrile
Give IUPAC name for following compounds.
Provide the IUPAC name of the following.
Provide the IUPAC name for the following.
Provide an IUPAC name for the following.
What is the IUPAC name of the depicted compound?
Name the following compound according to IUPAC rules.
Name the following compound according to the IUPAC rules.
What is the IUPAC name of the compound provided below?
Give the IUPAC name for the following compound a) (E)-4-ethyl-3-nonene b) (Z)-4-ethyl-3-nonene c) (E)-3-ethyl-4-nonene d) (E)-5-ethyl-5-nonene e) (E)-4-ethyl-3-octene
What is the IUPAC name of the below-mentioned compound?
What is the proper IUPAC name?
What is the IUPAC name of the compound mentioned below?
Provide the proper iupac name for the following
Provide the IUPAC name for the below compound.
Give IUPAC names for the following a) (CH_3)_2CHC(CH_3)_2CH_2CH_2CH_3
Give IUPAC names for the following: (a) CH_3CH_2CH_2Cl. (b) (CH_3)_3CCl. (c) CH_3CHClCH_2CH_3.
What can you say about the IUPAC name of the given compound?
What is the IUPAC name for the compound shown below? Explain your answer.
Give the IUPAC name for following alkane.
What is the IUPAC name for ClCH(Br)CH(I)CL?
Identify the given compound's IUPAC name.
What is the IUPAC name of the given molecule?
Write the IUPAC name for the next compound.
Provide the IUPAC name for the below molecule.
Identify the IUPAC name for the given compound.
Identify the IUPAC name of the given compound.
What is IUPAC name of the following compound? What is IUPAC name of the following compound?
Name the given compound by IUPAC.
What is the IUPAC name for the following compound? A) 3-Fluorobutane B) 2-Fluorobutane C) (S)-2-Fluorobutane D) (R)-2-Fluorobutane 3. What is the IUPAC name for the following compound?
What is the IUPAC name for the compound shown below? Explain.
Tell the IUPAC name of the below mentioned compound.
What is the IUPAC name of the following substance?
Identify the IUPAC name for the compound below.
Identify the IUPAC name of the compound.
Identify the IUPAC name of the compound below.
Identify the IUPAC name for the following compound.
Identify the IUPAC name of the following compound?
What is the IUPAC name for the compound below? (Compound)
What would the IUPAC name of the molecule H_2C=C=CH_2 be?
What is the IUPAC name of the following molecule?
What is the IUPAC name for the following molecule? \\ CH_3CH=CHCH_2CH=CHCH_2CH=CHCH_3
Give IUPAC name for the given compound: CH3CH2CH=CHCH2CH2CH3
Give IUPAC name for the given compound (red=O):
The IUPAC name of the given compound is
Give the IUPAC name for the given compound:
Give IUPAC name for the given compound.
Give IUPAC name for the given compound: CH3CH2CH=CHCH(CH3)2
Give IUPAC name for the given compound: H2C=CHCH2CH2CH=CHCH3
Give IUPAC name of the given compound:
Give the IUPAC name of the given compound.
Using the IUPAC rule, name for the following compound is:
What is the IUPAC name of CH_2(OH)CH_2(OH)?
Give the IUPAC name for each of the following:

What is the IUPAC name for the following ?

Question:

Amines:

Answer and Explanation:

Become a member and unlock all Study Answers

Ask a question

Search Answers

Learn more about this topic:

Related to this Question

Explore our homework questions and answers library