What is the IUPAC name for: CH3-CH2-CH2-CH2-CH2-CH3?

Question:

What is the IUPAC name for CH3-CH2-CH2-CH2-CH2-CH3?

Nomenclature:

The naming of organic compounds is based on a set of conditions which are given as the nomenclature of organic compounds. Some of the conditions to be followed are;

The suffix is 'ane' for compounds with single bonds.
The prefix is based on the Greek numeral.

Answer and Explanation:

Become a Study.com member to unlock this answer! Create your account

View this answer

See full answer below.

Learn more about this topic:

Naming Organic Compounds: Rules & Practice

from

Chapter 15 / Lesson 6

127K

Learn about IUPAC naming for organic compounds and molecules. Understand functional groups tables, use IUPAC name charts, and see IUPAC name examples.

Related to this Question

What is the IUPAC name of these? 1) ch3ch2c(ch3)2ch2ch2ch3 2) CH3CH(CH3)CH(CH3)CH2CH2CH3
What is the IUPAC name?
What is the IUPAC name? CH3 CH3CH-O-C3H5
What is the IUPAC name for
what is the IUPAC name of (CH3)2CH-O-C3H5
What is the IUPAC name for CH3-O-CH2-CH3?
What is the IUPAC name for ClCH(Br)CH(I)CL?
What is the proper IUPAC name?
What is this compound? Give the IUPAC name.
What is the IUPAC name for the compound seen below?
What is the IUPAC name for the following compound? CH3 CH2 CH2 CH2 CH3
What is the IUPAC name for this compound?
What is the IUPAC name of following compound?
What is the IUPAC name for the compound as seen below?
What is the IUPAC name of the compound?
What is the IUPAC name for the following compound seen below?
What is the IUPAC name of the following compound? CH3-C(CH3)2-CH2-CH2-OH
What is the IUPAC name for the compound?
What is the IUPAC name of the compound (1R, 2S, 3S)-2-Bromo-3, 3-difluoro-1-iodobutane.
What is the IUPAC name for the following compound? CH3-CH2-CH2-CH2-CH2-CH2-CH2-CH2-CH3
What is the IUPAC name for the compound below?
What is the IUPAC name for the following compound?
What is the IUPAC name for the following compound? (A) (25)-fluorobutanenitrile (B) (2R)-fluoropentanenitrile (C) (3R)-fluoropentanenitrile (D) (35)-fluoropentanenitrile
What is the IUPAC name of the compound below?
What is the IUPAC name of the following compound?
What is the IUPAC name of the following substance?
What is the IUPAC name of the given compound?
What is the IUPAC name for the given compound below?
What is the IUPAC name for the given compound?
What is the IUPAC name for the following molecule? \\ CH_3CH=CHCH_2CH=CHCH_2CH=CHCH_3
What would the IUPAC name of the molecule H_2C=C=CH_2 be?
What is the IUPAC name of the following molecule?
What is the correct IUPAC name?
What is the IUPAC name of the depicted compound?
What is the IUPAC name of the below-mentioned compound?
What is the IUPAC name of the following?
What is the IUPAC name for the following ?
What is the IUPAC name of the shown compound?
What is the IUPAC name of the given molecule?
What is IUPAC name of the following compound? What is IUPAC name of the following compound?
What is the IUPAC name of the compound mentioned below?
What is the IUPAC name of the compound provided below?
What is the IUPAC name of the compound shown?
What is the IUPAC name for the compound shown below? H2N
What is the IUPAC name for the compound shown below?
What is the IUPAC name for the compound shown below? H3C CH3 CH3 CH2
What is the IUPAC name for the following compound as shown below ?
What is the IUPAC name for the following compound shown below?
What is the IUPAC name of the following compound shown below?
What is the IUPAC name for the compound shown?
What is the IUPAC name for the compound shown below? HO
What is the IUPAC name for the following compound? A) 3-Fluorobutane B) 2-Fluorobutane C) (S)-2-Fluorobutane D) (R)-2-Fluorobutane 3. What is the IUPAC name for the following compound?
What can you say about the IUPAC name of the given compound?
1. IUPAC name is
Give the IUPAC name of BrCH2C=CCH2CH2OH.
Give the IUPAC name of CH2=CH-CH2-CH3.
The IUPAC name is
IUPAC name is _____
(CH3)2CHCH=CHCH2CH3 IUPAC name
Give the IUPAC name for A.
What is the IUPAC name for the below compound?
What is the IUPAC name for the following compounds? a. b. c. d.
What is the IUPAC name of H3As?
What is the IUPAC and common name of the compound?
The compound given has the IUPAC name as
For the compound, the IUPAC name is
The compound given below has the IUPAC name as:
The compound has the IUPAC name as
What is the IUPAC name for the compound below? (Compound)
What is the name of the given structure using IUPAC?
Name the given compound by IUPAC.
What is the IUPAC name for the below molecule?
What is the IUPAC name of the following complex? { [Co(NH_3)_5 (NO_2)](NO_3)_2 }
Give IUPAC name for the given compound: H2C=CHCH2CH2CH=CHCH3
The IUPAC name of the given compound is
Give IUPAC name for the given compound: CH3CH2CH=CHCH2CH2CH3
Give the IUPAC name for the given compound:
Give IUPAC name for the given compound: CH3CH2CH=CHCH(CH3)2
Give IUPAC name of the given compound:
Give IUPAC name for the given compound.
Give IUPAC name for the given compound (red=O):
Give the IUPAC name of the given compound.
Give the I.U.P.A.C. name of the following compound: CH_3CH_2CHClCHBrCH_2CH_2OH.
Give the IUPAC name for each compound. a. H-C?C=CH_2C(CH_2CH_2CH_3)_3 b. CH_3C?CC(CH_3)CICH_2CH_3 c. CH_2=CHCH_2CH(CH_2CH_3)C?CC(CH_3)_2CH_2CH_2CH_3
Give the IUPAC name for the following compound. 5,5-diethyl-4,7,8-trimethylnonane 4,4-diethyl-2,3,6-trimethylnonane 5,5-diethyl-2,3,6-trimethylnonane
Give the IUPAC name of the following compound:
Give the IUPAC name of the compound below.
Give the IUPAC name for the following compound:
Give the IUPAC name of the following compound: H_2C=CHCH=CHCH=CHCH_3.
IUPAC name of the following compound: CH3-CH2-CO-CH2-CH3
The IUPAC name for the compound is :
The IUPAC name for the following compound is:
Give the IUPAC name of the compound
Give the IUPAC name for the compound below.
Give the I.U.P.A.C. name of the following compound: CH_3C(CH_2CH_3)_2CH(CH_3)CH_2CH_2CH_2OH.
Give the IUPAC name of this compound.
The IUPAC name of the compound is
Give IUPAC name for the compound below.
Give the IUPAC name for this compound.
D the IUPAC name for the following compound?

What is the IUPAC name for: CH3-CH2-CH2-CH2-CH2-CH3?

Question:

Nomenclature:

Answer and Explanation:

Become a member and unlock all Study Answers

Ask a question

Search Answers

Learn more about this topic:

Related to this Question

Explore our homework questions and answers library